C33H42Cl2N8O2 — CID 71202697
4-[(1R)-1-[8-tert-butyl-2-(3,5-dichlorophenyl)-3-oxo-1,4,8-triazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]-N-(2H-tetrazol-5-ylmethyl)benzamide (PubChem CID 71202697) has the molecular formula C33H42Cl2N8O2 and a molecular weight of 653.66 g/mol. Its IUPAC name is 4-[(1R)-1-[8-tert-butyl-2-(3,5-dichlorophenyl)-3-oxo-1,4,8-triazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]-N-(2H-tetrazol-5-ylmethyl)benzamide.
| Compound Name | 4-[(1R)-1-[8-tert-butyl-2-(3,5-dichlorophenyl)-3-oxo-1,4,8-triazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]-N-(2H-tetrazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 71202697 |
| Molecular Formula | C33H42Cl2N8O2 |
| Molecular Weight | 653.66 g/mol |
| Exact Mass | 652.28 |
| IUPAC Name | 4-[(1R)-1-[8-tert-butyl-2-(3,5-dichlorophenyl)-3-oxo-1,4,8-triazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]-N-(2H-tetrazol-5-ylmethyl)benzamide |
| SMILES | CC(C)(C)CC[C@H](c1ccc(C(=O)NCc2nn[nH]n2)cc1)N1C(=O)C(c2cc(Cl)cc(Cl)c2)=NC12CCN(C(C)(C)C)CC2 |
| InChI | InChI=1S/C33H42Cl2N8O2/c1-31(2,3)12-11-26(21-7-9-22(10-8-21)29(44)36-20-27-38-40-41-39-27)43-30(45)28(23-17-24(34)19-25(35)18-23)37-33(43)13-15-42(16-14-33)32(4,5)6/h7-10,17-19,26H,11-16,20H2,1-6H3,(H,36,44)(H,38,39,40,41)/t26-/m1/s1 |
| InChIKey | NJSBQNFSZWBOKA-AREMUKBSSA-N |
| XLogP | 6.23 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.66 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |