About 4-[4-[3-[(2-methoxy-1,3-thiazol-4-yl)methyl]piperidin-1-yl]quinazolin-7-yl]morpholine
4-[4-[3-[(2-methoxy-1,3-thiazol-4-yl)methyl]piperidin-1-yl]quinazolin-7-yl]morpholine (PubChem CID 71202759) has the molecular formula C22H27N5O2S
and a molecular weight of 425.56 g/mol. Its IUPAC name is 4-[4-[3-[(2-methoxy-1,3-thiazol-4-yl)methyl]piperidin-1-yl]quinazolin-7-yl]morpholine.
Molecular Properties
| Compound Name | 4-[4-[3-[(2-methoxy-1,3-thiazol-4-yl)methyl]piperidin-1-yl]quinazolin-7-yl]morpholine |
| PubChem CID | 71202759 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 4-[4-[3-[(2-methoxy-1,3-thiazol-4-yl)methyl]piperidin-1-yl]quinazolin-7-yl]morpholine |
| SMILES | COc1nc(CC2CCCN(c3ncnc4cc(N5CCOCC5)ccc34)C2)cs1 |
| InChI | InChI=1S/C22H27N5O2S/c1-28-22-25-17(14-30-22)11-16-3-2-6-27(13-16)21-19-5-4-18(12-20(19)23-15-24-21)26-7-9-29-10-8-26/h4-5,12,14-16H,2-3,6-11,13H2,1H3 |
| InChIKey | ZHOHJTKKEJUVRO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[4-[3-[(2-methoxy-1,3-thiazol-4-yl)methyl]piperidin-1-yl]quinazolin-7-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[3-[(2-methoxy-1,3-thiazol-4-yl)methyl]piperidin-1-yl]quinazolin-7-yl]morpholine?
The IUPAC name of 4-[4-[3-[(2-methoxy-1,3-thiazol-4-yl)methyl]piperidin-1-yl]quinazolin-7-yl]morpholine (CID 71202759) is 4-[4-[3-[(2-methoxy-1,3-thiazol-4-yl)methyl]piperidin-1-yl]quinazolin-7-yl]morpholine.
What is the SMILES notation for 4-[4-[3-[(2-methoxy-1,3-thiazol-4-yl)methyl]piperidin-1-yl]quinazolin-7-yl]morpholine?
The canonical SMILES for 4-[4-[3-[(2-methoxy-1,3-thiazol-4-yl)methyl]piperidin-1-yl]quinazolin-7-yl]morpholine is COc1nc(CC2CCCN(c3ncnc4cc(N5CCOCC5)ccc34)C2)cs1.
What is the InChIKey of 4-[4-[3-[(2-methoxy-1,3-thiazol-4-yl)methyl]piperidin-1-yl]quinazolin-7-yl]morpholine?
The InChIKey is ZHOHJTKKEJUVRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N5O2S/c1-28-22-25-17(14-30-22)11-16-3-2-6-27(13-16)21-19-5-4-18(12-20(19)23-15-24-21)26-7-9-29-10-8-26/h4-5,12,14-16H,2-3,6-11,13H2,1H3.
What are the key properties of 4-[4-[3-[(2-methoxy-1,3-thiazol-4-yl)methyl]piperidin-1-yl]quinazolin-7-yl]morpholine?
4-[4-[3-[(2-methoxy-1,3-thiazol-4-yl)methyl]piperidin-1-yl]quinazolin-7-yl]morpholine has a molecular weight of 425.56 g/mol, XLogP of 3.39, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[3-[(2-methoxy-1,3-thiazol-4-yl)methyl]piperidin-1-yl]quinazolin-7-yl]morpholine is sourced from PubChem (CID 71202759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).