C28H19F5N2 — CID 71202852
4-[4-(1,1-difluoroethyl)phenyl]-7-[4-(2,2,2-trifluoroethyl)phenyl]-1,10-phenanthroline (PubChem CID 71202852) has the molecular formula C28H19F5N2 and a molecular weight of 478.46 g/mol. Its IUPAC name is 4-[4-(1,1-difluoroethyl)phenyl]-7-[4-(2,2,2-trifluoroethyl)phenyl]-1,10-phenanthroline.
| Compound Name | 4-[4-(1,1-difluoroethyl)phenyl]-7-[4-(2,2,2-trifluoroethyl)phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 71202852 |
| Molecular Formula | C28H19F5N2 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 4-[4-(1,1-difluoroethyl)phenyl]-7-[4-(2,2,2-trifluoroethyl)phenyl]-1,10-phenanthroline |
| SMILES | CC(F)(F)c1ccc(-c2ccnc3c2ccc2c(-c4ccc(CC(F)(F)F)cc4)ccnc23)cc1 |
| InChI | InChI=1S/C28H19F5N2/c1-27(29,30)20-8-6-19(7-9-20)22-13-15-35-26-24(22)11-10-23-21(12-14-34-25(23)26)18-4-2-17(3-5-18)16-28(31,32)33/h2-15H,16H2,1H3 |
| InChIKey | SQDOECVDRJLINL-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|