C53H30N10O — CID 71202873
4,20-bis[3,5-di(pyrimidin-2-yl)phenyl]-8,16-diazaheptacyclo[14.9.2.02,7.08,26.09,14.017,22.023,27]heptacosa-1(26),2(7),3,5,9,11,13,17(22),18,20,23(27),24-dodecaen-15-one (PubChem CID 71202873) has the molecular formula C53H30N10O and a molecular weight of 822.89 g/mol. Its IUPAC name is 4,20-bis[3,5-di(pyrimidin-2-yl)phenyl]-8,16-diazaheptacyclo[14.9.2.02,7.08,26.09,14.017,22.023,27]heptacosa-1(26),2(7),3,5,9,11,13,17(22),18,20,23(27),24-dodecaen-15-one.
| Compound Name | 4,20-bis[3,5-di(pyrimidin-2-yl)phenyl]-8,16-diazaheptacyclo[14.9.2.02,7.08,26.09,14.017,22.023,27]heptacosa-1(26),2(7),3,5,9,11,13,17(22),18,20,23(27),24-dodecaen-15-one |
|---|---|
| PubChem CID | 71202873 |
| Molecular Formula | C53H30N10O |
| Molecular Weight | 822.89 g/mol |
| Exact Mass | 822.26 |
| IUPAC Name | 4,20-bis[3,5-di(pyrimidin-2-yl)phenyl]-8,16-diazaheptacyclo[14.9.2.02,7.08,26.09,14.017,22.023,27]heptacosa-1(26),2(7),3,5,9,11,13,17(22),18,20,23(27),24-dodecaen-15-one |
| SMILES | O=c1c2ccccc2n2c3ccc(-c4cc(-c5ncccn5)cc(-c5ncccn5)c4)cc3c3ccc4c5cc(-c6cc(-c7ncccn7)cc(-c7ncccn7)c6)ccc5n1c4c32 |
| InChI | InChI=1S/C53H30N10O/c64-53-41-7-1-2-8-44(41)62-45-13-9-31(33-23-35(49-54-15-3-16-55-49)27-36(24-33)50-56-17-4-18-57-50)29-42(45)39-11-12-40-43-30-32(10-14-46(43)63(53)48(40)47(39)62)34-25-37(51-58-19-5-20-59-51)28-38(26-34)52-60-21-6-22-61-52/h1-30H |
| InChIKey | OHVCCDDAPLSEPL-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 129.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.89 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |