C16H15N3O2 — CID 71203112
2-anilino-3-(methoxymethyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 71203112) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-anilino-3-(methoxymethyl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-anilino-3-(methoxymethyl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 71203112 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-anilino-3-(methoxymethyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | COCc1c(Nc2ccccc2)nc2ccccn2c1=O |
| InChI | InChI=1S/C16H15N3O2/c1-21-11-13-15(17-12-7-3-2-4-8-12)18-14-9-5-6-10-19(14)16(13)20/h2-10,17H,11H2,1H3 |
| InChIKey | MGTDBXWCBBLJSJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |