About cis-ethyl (1S,2R)-2-(3-aminopropyl)-1-[1-(4-methylphenyl)imidazol-4-yl]cyclopropane-1-carboxylate
cis-ethyl (1S,2R)-2-(3-aminopropyl)-1-[1-(4-methylphenyl)imidazol-4-yl]cyclopropane-1-carboxylate (PubChem CID 71203333) has the molecular formula C19H25N3O2
and a molecular weight of 327.43 g/mol. Its IUPAC name is cis-ethyl (1S,2R)-2-(3-aminopropyl)-1-[1-(4-methylphenyl)imidazol-4-yl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | cis-ethyl (1S,2R)-2-(3-aminopropyl)-1-[1-(4-methylphenyl)imidazol-4-yl]cyclopropane-1-carboxylate |
| PubChem CID | 71203333 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | cis-ethyl (1S,2R)-2-(3-aminopropyl)-1-[1-(4-methylphenyl)imidazol-4-yl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(c2cn(-c3ccc(C)cc3)cn2)C[C@H]1CCCN |
| InChI | InChI=1S/C19H25N3O2/c1-3-24-18(23)19(11-15(19)5-4-10-20)17-12-22(13-21-17)16-8-6-14(2)7-9-16/h6-9,12-13,15H,3-5,10-11,20H2,1-2H3/t15-,19+/m1/s1 |
| InChIKey | LVXJMKKSUFMMJM-BEFAXECRSA-N |
| XLogP | 2.74 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cis-ethyl (1S,2R)-2-(3-aminopropyl)-1-[1-(4-methylphenyl)imidazol-4-yl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-ethyl (1S,2R)-2-(3-aminopropyl)-1-[1-(4-methylphenyl)imidazol-4-yl]cyclopropane-1-carboxylate?
The IUPAC name of cis-ethyl (1S,2R)-2-(3-aminopropyl)-1-[1-(4-methylphenyl)imidazol-4-yl]cyclopropane-1-carboxylate (CID 71203333) is cis-ethyl (1S,2R)-2-(3-aminopropyl)-1-[1-(4-methylphenyl)imidazol-4-yl]cyclopropane-1-carboxylate.
What is the SMILES notation for cis-ethyl (1S,2R)-2-(3-aminopropyl)-1-[1-(4-methylphenyl)imidazol-4-yl]cyclopropane-1-carboxylate?
The canonical SMILES for cis-ethyl (1S,2R)-2-(3-aminopropyl)-1-[1-(4-methylphenyl)imidazol-4-yl]cyclopropane-1-carboxylate is CCOC(=O)[C@@]1(c2cn(-c3ccc(C)cc3)cn2)C[C@H]1CCCN.
What is the InChIKey of cis-ethyl (1S,2R)-2-(3-aminopropyl)-1-[1-(4-methylphenyl)imidazol-4-yl]cyclopropane-1-carboxylate?
The InChIKey is LVXJMKKSUFMMJM-BEFAXECRSA-N. The full InChI is InChI=1S/C19H25N3O2/c1-3-24-18(23)19(11-15(19)5-4-10-20)17-12-22(13-21-17)16-8-6-14(2)7-9-16/h6-9,12-13,15H,3-5,10-11,20H2,1-2H3/t15-,19+/m1/s1.
What are the key properties of cis-ethyl (1S,2R)-2-(3-aminopropyl)-1-[1-(4-methylphenyl)imidazol-4-yl]cyclopropane-1-carboxylate?
cis-ethyl (1S,2R)-2-(3-aminopropyl)-1-[1-(4-methylphenyl)imidazol-4-yl]cyclopropane-1-carboxylate has a molecular weight of 327.43 g/mol, XLogP of 2.74, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cis-ethyl (1S,2R)-2-(3-aminopropyl)-1-[1-(4-methylphenyl)imidazol-4-yl]cyclopropane-1-carboxylate is sourced from PubChem (CID 71203333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).