About (4-chlorophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone
(4-chlorophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone (PubChem CID 71203505) has the molecular formula C20H21ClN2O3
and a molecular weight of 372.85 g/mol. Its IUPAC name is (4-chlorophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone.
Molecular Properties
| Compound Name | (4-chlorophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone |
| PubChem CID | 71203505 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (4-chlorophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone |
| SMILES | COc1ccc(C2=NN(C(=O)c3ccc(Cl)cc3)C(C)(C)C2)cc1OC |
| InChI | InChI=1S/C20H21ClN2O3/c1-20(2)12-16(14-7-10-17(25-3)18(11-14)26-4)22-23(20)19(24)13-5-8-15(21)9-6-13/h5-11H,12H2,1-4H3 |
| InChIKey | FXLLBGSVLZEWKY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-chlorophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone?
The IUPAC name of (4-chlorophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone (CID 71203505) is (4-chlorophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone.
What is the SMILES notation for (4-chlorophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone?
The canonical SMILES for (4-chlorophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone is COc1ccc(C2=NN(C(=O)c3ccc(Cl)cc3)C(C)(C)C2)cc1OC.
What is the InChIKey of (4-chlorophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone?
The InChIKey is FXLLBGSVLZEWKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21ClN2O3/c1-20(2)12-16(14-7-10-17(25-3)18(11-14)26-4)22-23(20)19(24)13-5-8-15(21)9-6-13/h5-11H,12H2,1-4H3.
What are the key properties of (4-chlorophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone?
(4-chlorophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone has a molecular weight of 372.85 g/mol, XLogP of 4.39, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-[3-(3,4-dimethoxyphenyl)-5,5-dimethyl-4H-pyrazol-1-yl]methanone is sourced from PubChem (CID 71203505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).