About 7,7-difluoro-1-propan-2-yl-3-(trifluoromethyl)-5,6-dihydro-4H-indazole
7,7-difluoro-1-propan-2-yl-3-(trifluoromethyl)-5,6-dihydro-4H-indazole (PubChem CID 71204340) has the molecular formula C11H13F5N2
and a molecular weight of 268.23 g/mol. Its IUPAC name is 7,7-difluoro-1-propan-2-yl-3-(trifluoromethyl)-5,6-dihydro-4H-indazole.
Molecular Properties
| Compound Name | 7,7-difluoro-1-propan-2-yl-3-(trifluoromethyl)-5,6-dihydro-4H-indazole |
| PubChem CID | 71204340 |
| Molecular Formula | C11H13F5N2 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 7,7-difluoro-1-propan-2-yl-3-(trifluoromethyl)-5,6-dihydro-4H-indazole |
| SMILES | CC(C)n1nc(C(F)(F)F)c2c1C(F)(F)CCC2 |
| InChI | InChI=1S/C11H13F5N2/c1-6(2)18-9-7(4-3-5-10(9,12)13)8(17-18)11(14,15)16/h6H,3-5H2,1-2H3 |
| InChIKey | RNIMDLXTTINION-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,7-difluoro-1-propan-2-yl-3-(trifluoromethyl)-5,6-dihydro-4H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-difluoro-1-propan-2-yl-3-(trifluoromethyl)-5,6-dihydro-4H-indazole?
The IUPAC name of 7,7-difluoro-1-propan-2-yl-3-(trifluoromethyl)-5,6-dihydro-4H-indazole (CID 71204340) is 7,7-difluoro-1-propan-2-yl-3-(trifluoromethyl)-5,6-dihydro-4H-indazole.
What is the SMILES notation for 7,7-difluoro-1-propan-2-yl-3-(trifluoromethyl)-5,6-dihydro-4H-indazole?
The canonical SMILES for 7,7-difluoro-1-propan-2-yl-3-(trifluoromethyl)-5,6-dihydro-4H-indazole is CC(C)n1nc(C(F)(F)F)c2c1C(F)(F)CCC2.
What is the InChIKey of 7,7-difluoro-1-propan-2-yl-3-(trifluoromethyl)-5,6-dihydro-4H-indazole?
The InChIKey is RNIMDLXTTINION-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F5N2/c1-6(2)18-9-7(4-3-5-10(9,12)13)8(17-18)11(14,15)16/h6H,3-5H2,1-2H3.
What are the key properties of 7,7-difluoro-1-propan-2-yl-3-(trifluoromethyl)-5,6-dihydro-4H-indazole?
7,7-difluoro-1-propan-2-yl-3-(trifluoromethyl)-5,6-dihydro-4H-indazole has a molecular weight of 268.23 g/mol, XLogP of 3.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-difluoro-1-propan-2-yl-3-(trifluoromethyl)-5,6-dihydro-4H-indazole is sourced from PubChem (CID 71204340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).