C30H23F5N5O2P — CID 71204358
5-[2-[(1S)-1-[6-(difluoromethyl)-10-oxo-7,8,11-triaza-12-phosphatetracyclo[6.4.1.02,4.05,13]trideca-5(13),6-dien-11-yl]-2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 71204358) has the molecular formula C30H23F5N5O2P and a molecular weight of 611.51 g/mol. Its IUPAC name is 5-[2-[(1S)-1-[6-(difluoromethyl)-10-oxo-7,8,11-triaza-12-phosphatetracyclo[6.4.1.02,4.05,13]trideca-5(13),6-dien-11-yl]-2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(1S)-1-[6-(difluoromethyl)-10-oxo-7,8,11-triaza-12-phosphatetracyclo[6.4.1.02,4.05,13]trideca-5(13),6-dien-11-yl]-2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 71204358 |
| Molecular Formula | C30H23F5N5O2P |
| Molecular Weight | 611.51 g/mol |
| Exact Mass | 611.15 |
| IUPAC Name | 5-[2-[(1S)-1-[6-(difluoromethyl)-10-oxo-7,8,11-triaza-12-phosphatetracyclo[6.4.1.02,4.05,13]trideca-5(13),6-dien-11-yl]-2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2cccnc2[C@H](Cc2cc(F)cc(F)c2)N2PC3c4c(c(C(F)F)nn4CC2=O)C2CC23)ccc1F |
| InChI | InChI=1S/C30H23F5N5O2P/c31-15-6-13(7-16(32)10-15)8-22(25-17(2-1-5-37-25)14-3-4-21(33)20(9-14)30(36)42)40-23(41)12-39-27-24(26(38-39)29(34)35)18-11-19(18)28(27)43-40/h1-7,9-10,18-19,22,28-29,43H,8,11-12H2,(H2,36,42)/t18?,19?,22-,28?/m0/s1 |
| InChIKey | KODQDTMLBREBAW-VJHPIBRESA-N |
| XLogP | 5.98 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|