C13H24N2O — CID 71204687
(3R,8aR)-3-tert-butyl-2,8a-dimethyl-5,6,7,8-tetrahydro-3H-imidazo[1,5-a]pyridin-1-one (PubChem CID 71204687) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is (3R,8aR)-3-tert-butyl-2,8a-dimethyl-5,6,7,8-tetrahydro-3H-imidazo[1,5-a]pyridin-1-one.
| Compound Name | (3R,8aR)-3-tert-butyl-2,8a-dimethyl-5,6,7,8-tetrahydro-3H-imidazo[1,5-a]pyridin-1-one |
|---|---|
| PubChem CID | 71204687 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (3R,8aR)-3-tert-butyl-2,8a-dimethyl-5,6,7,8-tetrahydro-3H-imidazo[1,5-a]pyridin-1-one |
| SMILES | CN1C(=O)[C@@]2(C)CCCCN2[C@H]1C(C)(C)C |
| InChI | InChI=1S/C13H24N2O/c1-12(2,3)10-14(5)11(16)13(4)8-6-7-9-15(10)13/h10H,6-9H2,1-5H3/t10-,13+/m0/s1 |
| InChIKey | ZDFAUFPGGXMWHY-GXFFZTMASA-N |
| XLogP | 2.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |