C12H22O3 — CID 71205221
(3R,6S)-3,6-bis(methoxymethyl)-2,4,5-trimethyl-3,6-dihydro-2H-pyran (PubChem CID 71205221) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (3R,6S)-3,6-bis(methoxymethyl)-2,4,5-trimethyl-3,6-dihydro-2H-pyran.
| Compound Name | (3R,6S)-3,6-bis(methoxymethyl)-2,4,5-trimethyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 71205221 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (3R,6S)-3,6-bis(methoxymethyl)-2,4,5-trimethyl-3,6-dihydro-2H-pyran |
| SMILES | COC[C@H]1OC(C)[C@@H](COC)C(C)=C1C |
| InChI | InChI=1S/C12H22O3/c1-8-9(2)12(7-14-5)15-10(3)11(8)6-13-4/h10-12H,6-7H2,1-5H3/t10?,11-,12+/m0/s1 |
| InChIKey | KOLRTJZIRSQTSS-GLXQMMQGSA-N |
| XLogP | 2.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|