C21H21F3N6O4 — CID 71205525
N-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]-1-(3,4,6-trifluoro-5-methyl-1-benzofuran-2-yl)methanimine (PubChem CID 71205525) has the molecular formula C21H21F3N6O4 and a molecular weight of 478.43 g/mol. Its IUPAC name is N-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]-1-(3,4,6-trifluoro-5-methyl-1-benzofuran-2-yl)methanimine.
| Compound Name | N-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]-1-(3,4,6-trifluoro-5-methyl-1-benzofuran-2-yl)methanimine |
|---|---|
| PubChem CID | 71205525 |
| Molecular Formula | C21H21F3N6O4 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]-1-(3,4,6-trifluoro-5-methyl-1-benzofuran-2-yl)methanimine |
| SMILES | Cc1c(F)cc2oc(C=NN3CCN(CC4(C)Cn5cc([N+](=O)[O-])nc5O4)CC3)c(F)c2c1F |
| InChI | InChI=1S/C21H21F3N6O4/c1-12-13(22)7-14-17(18(12)23)19(24)15(33-14)8-25-29-5-3-27(4-6-29)10-21(2)11-28-9-16(30(31)32)26-20(28)34-21/h7-9H,3-6,10-11H2,1-2H3 |
| InChIKey | GPDTUVCVXGFXJD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 102.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|