C21H15NS — CID 71205549
2-(2,5-diphenylphenyl)-1,3-thiazole (PubChem CID 71205549) has the molecular formula C21H15NS and a molecular weight of 313.43 g/mol. Its IUPAC name is 2-(2,5-diphenylphenyl)-1,3-thiazole.
| Compound Name | 2-(2,5-diphenylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 71205549 |
| Molecular Formula | C21H15NS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-(2,5-diphenylphenyl)-1,3-thiazole |
| SMILES | c1ccc(-c2ccc(-c3ccccc3)c(-c3nccs3)c2)cc1 |
| InChI | InChI=1S/C21H15NS/c1-3-7-16(8-4-1)18-11-12-19(17-9-5-2-6-10-17)20(15-18)21-22-13-14-23-21/h1-15H |
| InChIKey | NHSOLNDMCONCRX-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |