About cyclohexyl-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone
cyclohexyl-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone (PubChem CID 71205730) has the molecular formula C19H23FN2O
and a molecular weight of 314.40 g/mol. Its IUPAC name is cyclohexyl-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone.
Molecular Properties
| Compound Name | cyclohexyl-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone |
| PubChem CID | 71205730 |
| Molecular Formula | C19H23FN2O |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | cyclohexyl-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone |
| SMILES | Cn1c2c(c3cc(F)ccc31)CN(C(=O)C1CCCCC1)CC2 |
| InChI | InChI=1S/C19H23FN2O/c1-21-17-8-7-14(20)11-15(17)16-12-22(10-9-18(16)21)19(23)13-5-3-2-4-6-13/h7-8,11,13H,2-6,9-10,12H2,1H3 |
| InChIKey | CUNBGZRJIZLKKZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone?
The IUPAC name of cyclohexyl-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone (CID 71205730) is cyclohexyl-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone.
What is the SMILES notation for cyclohexyl-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone?
The canonical SMILES for cyclohexyl-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone is Cn1c2c(c3cc(F)ccc31)CN(C(=O)C1CCCCC1)CC2.
What is the InChIKey of cyclohexyl-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone?
The InChIKey is CUNBGZRJIZLKKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23FN2O/c1-21-17-8-7-14(20)11-15(17)16-12-22(10-9-18(16)21)19(23)13-5-3-2-4-6-13/h7-8,11,13H,2-6,9-10,12H2,1H3.
What are the key properties of cyclohexyl-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone?
cyclohexyl-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone has a molecular weight of 314.40 g/mol, XLogP of 3.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)methanone is sourced from PubChem (CID 71205730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).