C20H21ClN2O6 — CID 71205756
[3-[(4-chlorophenyl)methyl]-2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]imidazol-4-yl]methanetricarboxylic acid (PubChem CID 71205756) has the molecular formula C20H21ClN2O6 and a molecular weight of 420.85 g/mol. Its IUPAC name is [3-[(4-chlorophenyl)methyl]-2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]imidazol-4-yl]methanetricarboxylic acid.
| Compound Name | [3-[(4-chlorophenyl)methyl]-2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]imidazol-4-yl]methanetricarboxylic acid |
|---|---|
| PubChem CID | 71205756 |
| Molecular Formula | C20H21ClN2O6 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [3-[(4-chlorophenyl)methyl]-2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d]imidazol-4-yl]methanetricarboxylic acid |
| SMILES | CC(C)c1nc2c(n1Cc1ccc(Cl)cc1)C(C(C(=O)O)(C(=O)O)C(=O)O)CC2 |
| InChI | InChI=1S/C20H21ClN2O6/c1-10(2)16-22-14-8-7-13(20(17(24)25,18(26)27)19(28)29)15(14)23(16)9-11-3-5-12(21)6-4-11/h3-6,10,13H,7-9H2,1-2H3,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | ILEYEMGJUZSXBN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|