C31H37F4N7O2Si — CID 71205850
[3-fluoro-2-(trifluoromethyl)-4-pyridinyl]-[4-[3-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]azetidin-1-yl]piperidin-1-yl]methanone (PubChem CID 71205850) has the molecular formula C31H37F4N7O2Si and a molecular weight of 643.76 g/mol. Its IUPAC name is [3-fluoro-2-(trifluoromethyl)-4-pyridinyl]-[4-[3-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]azetidin-1-yl]piperidin-1-yl]methanone.
| Compound Name | [3-fluoro-2-(trifluoromethyl)-4-pyridinyl]-[4-[3-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]azetidin-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 71205850 |
| Molecular Formula | C31H37F4N7O2Si |
| Molecular Weight | 643.76 g/mol |
| Exact Mass | 643.27 |
| IUPAC Name | [3-fluoro-2-(trifluoromethyl)-4-pyridinyl]-[4-[3-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]azetidin-1-yl]piperidin-1-yl]methanone |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3ccn(C4CN(C5CCN(C(=O)c6ccnc(C(F)(F)F)c6F)CC5)C4)c3)ncnc21 |
| InChI | InChI=1S/C31H37F4N7O2Si/c1-45(2,3)15-14-44-20-41-13-8-25-27(37-19-38-29(25)41)21-5-10-40(16-21)23-17-42(18-23)22-6-11-39(12-7-22)30(43)24-4-9-36-28(26(24)32)31(33,34)35/h4-5,8-10,13,16,19,22-23H,6-7,11-12,14-15,17-18,20H2,1-3H3 |
| InChIKey | GNZURWLNDABTPE-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 81.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.76 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|