C30H36F4N8O2Si — CID 71205912
[3-fluoro-2-(trifluoromethyl)-4-pyridinyl]-[4-[3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidin-1-yl]methanone (PubChem CID 71205912) has the molecular formula C30H36F4N8O2Si and a molecular weight of 644.75 g/mol. Its IUPAC name is [3-fluoro-2-(trifluoromethyl)-4-pyridinyl]-[4-[3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidin-1-yl]methanone.
| Compound Name | [3-fluoro-2-(trifluoromethyl)-4-pyridinyl]-[4-[3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 71205912 |
| Molecular Formula | C30H36F4N8O2Si |
| Molecular Weight | 644.75 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | [3-fluoro-2-(trifluoromethyl)-4-pyridinyl]-[4-[3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidin-1-yl]methanone |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C4CN(C5CCN(C(=O)c6ccnc(C(F)(F)F)c6F)CC5)C4)c3)ncnc21 |
| InChI | InChI=1S/C30H36F4N8O2Si/c1-45(2,3)13-12-44-19-40-11-7-24-26(36-18-37-28(24)40)20-14-38-42(15-20)22-16-41(17-22)21-5-9-39(10-6-21)29(43)23-4-8-35-27(25(23)31)30(32,33)34/h4,7-8,11,14-15,18,21-22H,5-6,9-10,12-13,16-17,19H2,1-3H3 |
| InChIKey | MVCIEXMFNJMTCF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 94.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.75 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|