C14H20O3 — CID 71206125
(3R,3aS,4S,7aR)-4-acetyl-5-ethyl-3,6-dimethyl-3a,4,5,7a-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 71206125) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (3R,3aS,4S,7aR)-4-acetyl-5-ethyl-3,6-dimethyl-3a,4,5,7a-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | (3R,3aS,4S,7aR)-4-acetyl-5-ethyl-3,6-dimethyl-3a,4,5,7a-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 71206125 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (3R,3aS,4S,7aR)-4-acetyl-5-ethyl-3,6-dimethyl-3a,4,5,7a-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | CCC1C(C)=C[C@H]2C(=O)O[C@H](C)[C@H]2[C@H]1C(C)=O |
| InChI | InChI=1S/C14H20O3/c1-5-10-7(2)6-11-13(12(10)8(3)15)9(4)17-14(11)16/h6,9-13H,5H2,1-4H3/t9-,10?,11-,12+,13-/m1/s1 |
| InChIKey | DMKHMOGMZSJAPE-JVGWCMFKSA-N |
| XLogP | 2.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|