About 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-hydroxy-6-methyl-2H-pyridine
3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-hydroxy-6-methyl-2H-pyridine (PubChem CID 71206868) has the molecular formula C16H19FN4O2
and a molecular weight of 318.35 g/mol. Its IUPAC name is 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-hydroxy-6-methyl-2H-pyridine.
Molecular Properties
| Compound Name | 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-hydroxy-6-methyl-2H-pyridine |
| PubChem CID | 71206868 |
| Molecular Formula | C16H19FN4O2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-hydroxy-6-methyl-2H-pyridine |
| SMILES | CO[C@H](c1ccc(C2=CC=C(C)N(O)C2)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C16H19FN4O2/c1-11-3-4-14(10-21(11)22)12-5-7-13(8-6-12)16(23-2)15(9-17)19-20-18/h3-8,15-16,22H,9-10H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | YRIYKVLGYWXUDP-HZPDHXFCSA-N |
| XLogP | 4.01 |
| TPSA | 81.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-hydroxy-6-methyl-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-hydroxy-6-methyl-2H-pyridine?
The IUPAC name of 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-hydroxy-6-methyl-2H-pyridine (CID 71206868) is 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-hydroxy-6-methyl-2H-pyridine.
What is the SMILES notation for 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-hydroxy-6-methyl-2H-pyridine?
The canonical SMILES for 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-hydroxy-6-methyl-2H-pyridine is CO[C@H](c1ccc(C2=CC=C(C)N(O)C2)cc1)[C@@H](CF)N=[N+]=[N-].
What is the InChIKey of 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-hydroxy-6-methyl-2H-pyridine?
The InChIKey is YRIYKVLGYWXUDP-HZPDHXFCSA-N. The full InChI is InChI=1S/C16H19FN4O2/c1-11-3-4-14(10-21(11)22)12-5-7-13(8-6-12)16(23-2)15(9-17)19-20-18/h3-8,15-16,22H,9-10H2,1-2H3/t15-,16-/m1/s1.
What are the key properties of 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-hydroxy-6-methyl-2H-pyridine?
3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-hydroxy-6-methyl-2H-pyridine has a molecular weight of 318.35 g/mol, XLogP of 4.01, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-hydroxy-6-methyl-2H-pyridine is sourced from PubChem (CID 71206868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).