C17H30O4 — CID 71207019
4-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethenyl]-2,2-diethyl-5-methyl-1,3-dioxolane (PubChem CID 71207019) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is 4-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethenyl]-2,2-diethyl-5-methyl-1,3-dioxolane.
| Compound Name | 4-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethenyl]-2,2-diethyl-5-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 71207019 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 4-[2-(2,2-diethyl-1,3-dioxolan-4-yl)ethenyl]-2,2-diethyl-5-methyl-1,3-dioxolane |
| SMILES | CCC1(CC)OCC(C=CC2OC(CC)(CC)OC2C)O1 |
| InChI | InChI=1S/C17H30O4/c1-6-16(7-2)18-12-14(20-16)10-11-15-13(5)19-17(8-3,9-4)21-15/h10-11,13-15H,6-9,12H2,1-5H3 |
| InChIKey | TZBHAFPGYWGOQM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|