C14H17FN2O3 — CID 71207495
(6aS,8S)-8-fluoro-2,3-dimethoxy-5,6,6a,7,8,9-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 71207495) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is (6aS,8S)-8-fluoro-2,3-dimethoxy-5,6,6a,7,8,9-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS,8S)-8-fluoro-2,3-dimethoxy-5,6,6a,7,8,9-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 71207495 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (6aS,8S)-8-fluoro-2,3-dimethoxy-5,6,6a,7,8,9-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | COc1cc2c(cc1OC)C(=O)N1C[C@@H](F)C[C@H]1CN2 |
| InChI | InChI=1S/C14H17FN2O3/c1-19-12-4-10-11(5-13(12)20-2)16-6-9-3-8(15)7-17(9)14(10)18/h4-5,8-9,16H,3,6-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | JCOYJDONQNWKQH-IUCAKERBSA-N |
| XLogP | 1.68 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|