About 8-bromo-N,N-bis[(4-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidin-4-amine
8-bromo-N,N-bis[(4-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidin-4-amine (PubChem CID 71207858) has the molecular formula C23H21BrN4O2
and a molecular weight of 465.35 g/mol. Its IUPAC name is 8-bromo-N,N-bis[(4-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 8-bromo-N,N-bis[(4-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidin-4-amine |
| PubChem CID | 71207858 |
| Molecular Formula | C23H21BrN4O2 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 8-bromo-N,N-bis[(4-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2ncnc3c(Br)cncc23)cc1 |
| InChI | InChI=1S/C23H21BrN4O2/c1-29-18-7-3-16(4-8-18)13-28(14-17-5-9-19(30-2)10-6-17)23-20-11-25-12-21(24)22(20)26-15-27-23/h3-12,15H,13-14H2,1-2H3 |
| InChIKey | AZBHMGMQELJYIX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-bromo-N,N-bis[(4-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-N,N-bis[(4-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidin-4-amine?
The IUPAC name of 8-bromo-N,N-bis[(4-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidin-4-amine (CID 71207858) is 8-bromo-N,N-bis[(4-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidin-4-amine.
What is the SMILES notation for 8-bromo-N,N-bis[(4-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidin-4-amine?
The canonical SMILES for 8-bromo-N,N-bis[(4-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidin-4-amine is COc1ccc(CN(Cc2ccc(OC)cc2)c2ncnc3c(Br)cncc23)cc1.
What is the InChIKey of 8-bromo-N,N-bis[(4-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidin-4-amine?
The InChIKey is AZBHMGMQELJYIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21BrN4O2/c1-29-18-7-3-16(4-8-18)13-28(14-17-5-9-19(30-2)10-6-17)23-20-11-25-12-21(24)22(20)26-15-27-23/h3-12,15H,13-14H2,1-2H3.
What are the key properties of 8-bromo-N,N-bis[(4-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidin-4-amine?
8-bromo-N,N-bis[(4-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidin-4-amine has a molecular weight of 465.35 g/mol, XLogP of 5.01, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-N,N-bis[(4-methoxyphenyl)methyl]pyrido[4,3-d]pyrimidin-4-amine is sourced from PubChem (CID 71207858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).