About methyl 7-chloro-3-[[(3,4-dichlorobenzoyl)amino]methyl]-4-oxo-1-phenylquinoline-2-carboxylate
methyl 7-chloro-3-[[(3,4-dichlorobenzoyl)amino]methyl]-4-oxo-1-phenylquinoline-2-carboxylate (PubChem CID 71208335) has the molecular formula C25H17Cl3N2O4
and a molecular weight of 515.78 g/mol. Its IUPAC name is methyl 7-chloro-3-[[(3,4-dichlorobenzoyl)amino]methyl]-4-oxo-1-phenylquinoline-2-carboxylate.
Molecular Properties
| Compound Name | methyl 7-chloro-3-[[(3,4-dichlorobenzoyl)amino]methyl]-4-oxo-1-phenylquinoline-2-carboxylate |
| PubChem CID | 71208335 |
| Molecular Formula | C25H17Cl3N2O4 |
| Molecular Weight | 515.78 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | methyl 7-chloro-3-[[(3,4-dichlorobenzoyl)amino]methyl]-4-oxo-1-phenylquinoline-2-carboxylate |
| SMILES | COC(=O)c1c(CNC(=O)c2ccc(Cl)c(Cl)c2)c(=O)c2ccc(Cl)cc2n1-c1ccccc1 |
| InChI | InChI=1S/C25H17Cl3N2O4/c1-34-25(33)22-18(13-29-24(32)14-7-10-19(27)20(28)11-14)23(31)17-9-8-15(26)12-21(17)30(22)16-5-3-2-4-6-16/h2-12H,13H2,1H3,(H,29,32) |
| InChIKey | SBRZUOJDCIEIPR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 515.78 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 7-chloro-3-[[(3,4-dichlorobenzoyl)amino]methyl]-4-oxo-1-phenylquinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-chloro-3-[[(3,4-dichlorobenzoyl)amino]methyl]-4-oxo-1-phenylquinoline-2-carboxylate?
The IUPAC name of methyl 7-chloro-3-[[(3,4-dichlorobenzoyl)amino]methyl]-4-oxo-1-phenylquinoline-2-carboxylate (CID 71208335) is methyl 7-chloro-3-[[(3,4-dichlorobenzoyl)amino]methyl]-4-oxo-1-phenylquinoline-2-carboxylate.
What is the SMILES notation for methyl 7-chloro-3-[[(3,4-dichlorobenzoyl)amino]methyl]-4-oxo-1-phenylquinoline-2-carboxylate?
The canonical SMILES for methyl 7-chloro-3-[[(3,4-dichlorobenzoyl)amino]methyl]-4-oxo-1-phenylquinoline-2-carboxylate is COC(=O)c1c(CNC(=O)c2ccc(Cl)c(Cl)c2)c(=O)c2ccc(Cl)cc2n1-c1ccccc1.
What is the InChIKey of methyl 7-chloro-3-[[(3,4-dichlorobenzoyl)amino]methyl]-4-oxo-1-phenylquinoline-2-carboxylate?
The InChIKey is SBRZUOJDCIEIPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17Cl3N2O4/c1-34-25(33)22-18(13-29-24(32)14-7-10-19(27)20(28)11-14)23(31)17-9-8-15(26)12-21(17)30(22)16-5-3-2-4-6-16/h2-12H,13H2,1H3,(H,29,32).
What are the key properties of methyl 7-chloro-3-[[(3,4-dichlorobenzoyl)amino]methyl]-4-oxo-1-phenylquinoline-2-carboxylate?
methyl 7-chloro-3-[[(3,4-dichlorobenzoyl)amino]methyl]-4-oxo-1-phenylquinoline-2-carboxylate has a molecular weight of 515.78 g/mol, XLogP of 5.67, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-chloro-3-[[(3,4-dichlorobenzoyl)amino]methyl]-4-oxo-1-phenylquinoline-2-carboxylate is sourced from PubChem (CID 71208335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).