methyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate

C10H8N2O3 — CID 712092

IUPACmethyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate
SMILESCOC(=O)c1noc(-c2ccccc2)n1
InChIInChI=1S/C10H8N2O3/c1-14-10(13)8-11-9(15-12-8)7-5-3-2-4-6-7/h2-6H,1H3
InChIKeyGBLKMWNAOLRGES-UHFFFAOYSA-N
MW204.18 g/mol
LogP1.52
Rot. Bonds2

About methyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate

methyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate (PubChem CID 712092) has the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. Its IUPAC name is methyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate.

Molecular Properties

Compound Namemethyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate
PubChem CID712092
Molecular FormulaC10H8N2O3
Molecular Weight204.18 g/mol
Exact Mass204.05
IUPAC Namemethyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate
SMILESCOC(=O)c1noc(-c2ccccc2)n1
InChIInChI=1S/C10H8N2O3/c1-14-10(13)8-11-9(15-12-8)7-5-3-2-4-6-7/h2-6H,1H3
InChIKeyGBLKMWNAOLRGES-UHFFFAOYSA-N
XLogP1.52
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.18
LogP ≤ 51.52
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate?
The IUPAC name of methyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate (CID 712092) is methyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate.
What is the SMILES notation for methyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate?
The canonical SMILES for methyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate is COC(=O)c1noc(-c2ccccc2)n1.
What is the InChIKey of methyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate?
The InChIKey is GBLKMWNAOLRGES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3/c1-14-10(13)8-11-9(15-12-8)7-5-3-2-4-6-7/h2-6H,1H3.
What are the key properties of methyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate?
methyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate has a molecular weight of 204.18 g/mol, XLogP of 1.52, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-phenyl-1,2,4-oxadiazole-3-carboxylate is sourced from PubChem (CID 712092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).