About [N'-(2,6-dimethylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate
[N'-(2,6-dimethylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate (PubChem CID 71209432) has the molecular formula C14H20N2O2S
and a molecular weight of 280.39 g/mol. Its IUPAC name is [N'-(2,6-dimethylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate.
Molecular Properties
| Compound Name | [N'-(2,6-dimethylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate |
| PubChem CID | 71209432 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | [N'-(2,6-dimethylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate |
| SMILES | Cc1cccc(C)c1/N=C(/N)SCOC(=O)C(C)C |
| InChI | InChI=1S/C14H20N2O2S/c1-9(2)13(17)18-8-19-14(15)16-12-10(3)6-5-7-11(12)4/h5-7,9H,8H2,1-4H3,(H2,15,16) |
| InChIKey | MSMBTALLKABZGH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [N'-(2,6-dimethylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [N'-(2,6-dimethylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate?
The IUPAC name of [N'-(2,6-dimethylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate (CID 71209432) is [N'-(2,6-dimethylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate.
What is the SMILES notation for [N'-(2,6-dimethylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate?
The canonical SMILES for [N'-(2,6-dimethylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate is Cc1cccc(C)c1/N=C(/N)SCOC(=O)C(C)C.
What is the InChIKey of [N'-(2,6-dimethylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate?
The InChIKey is MSMBTALLKABZGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2S/c1-9(2)13(17)18-8-19-14(15)16-12-10(3)6-5-7-11(12)4/h5-7,9H,8H2,1-4H3,(H2,15,16).
What are the key properties of [N'-(2,6-dimethylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate?
[N'-(2,6-dimethylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate has a molecular weight of 280.39 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [N'-(2,6-dimethylphenyl)carbamimidoyl]sulfanylmethyl 2-methylpropanoate is sourced from PubChem (CID 71209432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).