C20H25IO6 — CID 71209531
methyl (3S,7S,11S,12S)-8-iodo-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene-11-carboxylate (PubChem CID 71209531) has the molecular formula C20H25IO6 and a molecular weight of 488.32 g/mol. Its IUPAC name is methyl (3S,7S,11S,12S)-8-iodo-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene-11-carboxylate.
| Compound Name | methyl (3S,7S,11S,12S)-8-iodo-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene-11-carboxylate |
|---|---|
| PubChem CID | 71209531 |
| Molecular Formula | C20H25IO6 |
| Molecular Weight | 488.32 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | methyl (3S,7S,11S,12S)-8-iodo-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene-11-carboxylate |
| SMILES | COC(=O)[C@]12C=CC(C3OC(C)(C)O[C@H]31)C1C2C=C(I)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C20H25IO6/c1-18(2)25-14-11(21)8-10-12(15(14)26-18)9-6-7-20(10,17(22)23-5)16-13(9)24-19(3,4)27-16/h6-10,12-16H,1-5H3/t9?,10?,12?,13?,14-,15+,16-,20+/m1/s1 |
| InChIKey | POOBKNAJDURHQA-UELICQNDSA-N |
| XLogP | 2.95 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|