About 7'-hydroxy-3-methylspiro[3H-chromene-2,2'-chromene]-4-one
7'-hydroxy-3-methylspiro[3H-chromene-2,2'-chromene]-4-one (PubChem CID 71209868) has the molecular formula C18H14O4
and a molecular weight of 294.31 g/mol. Its IUPAC name is 7'-hydroxy-3-methylspiro[3H-chromene-2,2'-chromene]-4-one.
Molecular Properties
| Compound Name | 7'-hydroxy-3-methylspiro[3H-chromene-2,2'-chromene]-4-one |
| PubChem CID | 71209868 |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 7'-hydroxy-3-methylspiro[3H-chromene-2,2'-chromene]-4-one |
| SMILES | CC1C(=O)c2ccccc2OC12C=Cc1ccc(O)cc1O2 |
| InChI | InChI=1S/C18H14O4/c1-11-17(20)14-4-2-3-5-15(14)21-18(11)9-8-12-6-7-13(19)10-16(12)22-18/h2-11,19H,1H3 |
| InChIKey | ONWWUFWPXFIBJP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7'-hydroxy-3-methylspiro[3H-chromene-2,2'-chromene]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7'-hydroxy-3-methylspiro[3H-chromene-2,2'-chromene]-4-one?
The IUPAC name of 7'-hydroxy-3-methylspiro[3H-chromene-2,2'-chromene]-4-one (CID 71209868) is 7'-hydroxy-3-methylspiro[3H-chromene-2,2'-chromene]-4-one.
What is the SMILES notation for 7'-hydroxy-3-methylspiro[3H-chromene-2,2'-chromene]-4-one?
The canonical SMILES for 7'-hydroxy-3-methylspiro[3H-chromene-2,2'-chromene]-4-one is CC1C(=O)c2ccccc2OC12C=Cc1ccc(O)cc1O2.
What is the InChIKey of 7'-hydroxy-3-methylspiro[3H-chromene-2,2'-chromene]-4-one?
The InChIKey is ONWWUFWPXFIBJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O4/c1-11-17(20)14-4-2-3-5-15(14)21-18(11)9-8-12-6-7-13(19)10-16(12)22-18/h2-11,19H,1H3.
What are the key properties of 7'-hydroxy-3-methylspiro[3H-chromene-2,2'-chromene]-4-one?
7'-hydroxy-3-methylspiro[3H-chromene-2,2'-chromene]-4-one has a molecular weight of 294.31 g/mol, XLogP of 3.41, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7'-hydroxy-3-methylspiro[3H-chromene-2,2'-chromene]-4-one is sourced from PubChem (CID 71209868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).