C29H43N3O5 — CID 71209951
(1S,12S,14R)-N-[6-(3,3-dimethylbutanoylamino)hexyl]-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide (PubChem CID 71209951) has the molecular formula C29H43N3O5 and a molecular weight of 513.68 g/mol. Its IUPAC name is (1S,12S,14R)-N-[6-(3,3-dimethylbutanoylamino)hexyl]-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide.
| Compound Name | (1S,12S,14R)-N-[6-(3,3-dimethylbutanoylamino)hexyl]-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 71209951 |
| Molecular Formula | C29H43N3O5 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | (1S,12S,14R)-N-[6-(3,3-dimethylbutanoylamino)hexyl]-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](O)C=C[C@@]31CCN(C(=O)NCCCCCCNC(=O)CC(C)(C)C)C2 |
| InChI | InChI=1S/C29H43N3O5/c1-28(2,3)18-24(34)30-14-7-5-6-8-15-31-27(35)32-16-13-29-12-11-21(33)17-23(29)37-26-22(36-4)10-9-20(19-32)25(26)29/h9-12,21,23,33H,5-8,13-19H2,1-4H3,(H,30,34)(H,31,35)/t21-,23-,29-/m0/s1 |
| InChIKey | UXIFPWYVQNHCDR-PLIGCNLOSA-N |
| XLogP | 4.04 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|