C16H16S4 — CID 71210359
5,6-diethyl-11,12-dimethyl-2,3,8,9-tetrathiatetracyclo[5.5.2.04,13.010,14]tetradeca-1(13),4,6,10(14),11-pentaene (PubChem CID 71210359) has the molecular formula C16H16S4 and a molecular weight of 336.57 g/mol. Its IUPAC name is 5,6-diethyl-11,12-dimethyl-2,3,8,9-tetrathiatetracyclo[5.5.2.04,13.010,14]tetradeca-1(13),4,6,10(14),11-pentaene.
| Compound Name | 5,6-diethyl-11,12-dimethyl-2,3,8,9-tetrathiatetracyclo[5.5.2.04,13.010,14]tetradeca-1(13),4,6,10(14),11-pentaene |
|---|---|
| PubChem CID | 71210359 |
| Molecular Formula | C16H16S4 |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 5,6-diethyl-11,12-dimethyl-2,3,8,9-tetrathiatetracyclo[5.5.2.04,13.010,14]tetradeca-1(13),4,6,10(14),11-pentaene |
| SMILES | CCc1c(CC)c2c3c(c(C)c(C)c4c3c1SS4)SS2 |
| InChI | InChI=1S/C16H16S4/c1-5-9-10(6-2)16-12-11-13(17-19-15(9)11)7(3)8(4)14(12)18-20-16/h5-6H2,1-4H3 |
| InChIKey | GSASONQXXOCLAS-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|