C33H46O14 — CID 71210609
bis[[(1S,2S,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl] (1R,2R,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 71210609) has the molecular formula C33H46O14 and a molecular weight of 666.72 g/mol. Its IUPAC name is bis[[(1S,2S,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl] (1R,2R,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis[[(1S,2S,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl] (1R,2R,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 71210609 |
| Molecular Formula | C33H46O14 |
| Molecular Weight | 666.72 g/mol |
| Exact Mass | 666.29 |
| IUPAC Name | bis[[(1S,2S,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl] (1R,2R,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CC1(C)O[C@@H]2O[C@H](COC(=O)[C@H]3[C@H](C(=O)OC[C@H]4O[C@H]5OC(C)(C)O[C@H]5[C@H]5OC(C)(C)O[C@H]54)[C@H]4C=C[C@@H]3C4)[C@@H]3OC(C)(C)O[C@@H]3[C@@H]2O1 |
| InChI | InChI=1S/C33H46O14/c1-30(2)40-20-16(38-28-24(22(20)42-30)44-32(5,6)46-28)12-36-26(34)18-14-9-10-15(11-14)19(18)27(35)37-13-17-21-23(43-31(3,4)41-21)25-29(39-17)47-33(7,8)45-25/h9-10,14-25,28-29H,11-13H2,1-8H3/t14-,15+,16-,17-,18-,19-,20+,21+,22+,23+,24+,25+,28+,29+/m1/s1 |
| InChIKey | IDZLQNIOVYJURA-YRPTWFMFSA-N |
| XLogP | 2.30 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.72 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|