C25H42F3N3O4 — CID 71211024
ethyl (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2R)-1-(2,2,2-trifluoroethyl)piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoate (PubChem CID 71211024) has the molecular formula C25H42F3N3O4 and a molecular weight of 505.62 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2R)-1-(2,2,2-trifluoroethyl)piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2R)-1-(2,2,2-trifluoroethyl)piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 71211024 |
| Molecular Formula | C25H42F3N3O4 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.31 |
| IUPAC Name | ethyl (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2R)-1-(2,2,2-trifluoroethyl)piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)[C@@H](NC(=O)[C@H]1CCCCN1CC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C25H42F3N3O4/c1-9-35-23(34)17(4)14-19(16(2)3)30(8)22(33)20(24(5,6)7)29-21(32)18-12-10-11-13-31(18)15-25(26,27)28/h14,16,18-20H,9-13,15H2,1-8H3,(H,29,32)/b17-14+/t18-,19-,20-/m1/s1 |
| InChIKey | IXPWTFGYDOOTIS-PGLMLKKXSA-N |
| XLogP | 3.93 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|