C23H38F3N3O4 — CID 71211067
(E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2R)-1-(2,2,2-trifluoroethyl)piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid (PubChem CID 71211067) has the molecular formula C23H38F3N3O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2R)-1-(2,2,2-trifluoroethyl)piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid.
| Compound Name | (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2R)-1-(2,2,2-trifluoroethyl)piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 71211067 |
| Molecular Formula | C23H38F3N3O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2R)-1-(2,2,2-trifluoroethyl)piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)[C@@H](NC(=O)[C@H]1CCCCN1CC(F)(F)F)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C23H38F3N3O4/c1-14(2)17(12-15(3)21(32)33)28(7)20(31)18(22(4,5)6)27-19(30)16-10-8-9-11-29(16)13-23(24,25)26/h12,14,16-18H,8-11,13H2,1-7H3,(H,27,30)(H,32,33)/b15-12+/t16-,17-,18-/m1/s1 |
| InChIKey | UWCMLSAEWAYUEB-YJXBEOEHSA-N |
| XLogP | 3.45 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|