About 4-[(4-bromocyclohexa-1,3-dien-1-yl)methoxy]-1-(2-fluorophenyl)-2-(trifluoromethyl)benzene
4-[(4-bromocyclohexa-1,3-dien-1-yl)methoxy]-1-(2-fluorophenyl)-2-(trifluoromethyl)benzene (PubChem CID 71211305) has the molecular formula C20H15BrF4O
and a molecular weight of 427.24 g/mol. Its IUPAC name is 4-[(4-bromocyclohexa-1,3-dien-1-yl)methoxy]-1-(2-fluorophenyl)-2-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 4-[(4-bromocyclohexa-1,3-dien-1-yl)methoxy]-1-(2-fluorophenyl)-2-(trifluoromethyl)benzene |
| PubChem CID | 71211305 |
| Molecular Formula | C20H15BrF4O |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 4-[(4-bromocyclohexa-1,3-dien-1-yl)methoxy]-1-(2-fluorophenyl)-2-(trifluoromethyl)benzene |
| SMILES | Fc1ccccc1-c1ccc(OCC2=CC=C(Br)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H15BrF4O/c21-14-7-5-13(6-8-14)12-26-15-9-10-16(18(11-15)20(23,24)25)17-3-1-2-4-19(17)22/h1-5,7,9-11H,6,8,12H2 |
| InChIKey | CHAYUBPFDBHSGC-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(4-bromocyclohexa-1,3-dien-1-yl)methoxy]-1-(2-fluorophenyl)-2-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-bromocyclohexa-1,3-dien-1-yl)methoxy]-1-(2-fluorophenyl)-2-(trifluoromethyl)benzene?
The IUPAC name of 4-[(4-bromocyclohexa-1,3-dien-1-yl)methoxy]-1-(2-fluorophenyl)-2-(trifluoromethyl)benzene (CID 71211305) is 4-[(4-bromocyclohexa-1,3-dien-1-yl)methoxy]-1-(2-fluorophenyl)-2-(trifluoromethyl)benzene.
What is the SMILES notation for 4-[(4-bromocyclohexa-1,3-dien-1-yl)methoxy]-1-(2-fluorophenyl)-2-(trifluoromethyl)benzene?
The canonical SMILES for 4-[(4-bromocyclohexa-1,3-dien-1-yl)methoxy]-1-(2-fluorophenyl)-2-(trifluoromethyl)benzene is Fc1ccccc1-c1ccc(OCC2=CC=C(Br)CC2)cc1C(F)(F)F.
What is the InChIKey of 4-[(4-bromocyclohexa-1,3-dien-1-yl)methoxy]-1-(2-fluorophenyl)-2-(trifluoromethyl)benzene?
The InChIKey is CHAYUBPFDBHSGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15BrF4O/c21-14-7-5-13(6-8-14)12-26-15-9-10-16(18(11-15)20(23,24)25)17-3-1-2-4-19(17)22/h1-5,7,9-11H,6,8,12H2.
What are the key properties of 4-[(4-bromocyclohexa-1,3-dien-1-yl)methoxy]-1-(2-fluorophenyl)-2-(trifluoromethyl)benzene?
4-[(4-bromocyclohexa-1,3-dien-1-yl)methoxy]-1-(2-fluorophenyl)-2-(trifluoromethyl)benzene has a molecular weight of 427.24 g/mol, XLogP of 6.89, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-bromocyclohexa-1,3-dien-1-yl)methoxy]-1-(2-fluorophenyl)-2-(trifluoromethyl)benzene is sourced from PubChem (CID 71211305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).