About N-phenyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline
N-phenyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline (PubChem CID 71211638) has the molecular formula C18H22F3NOSi
and a molecular weight of 353.46 g/mol. Its IUPAC name is N-phenyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline.
Molecular Properties
| Compound Name | N-phenyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline |
| PubChem CID | 71211638 |
| Molecular Formula | C18H22F3NOSi |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-phenyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline |
| SMILES | CC(O[Si](C)(C)C)(c1ccc(Nc2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H22F3NOSi/c1-17(18(19,20)21,23-24(2,3)4)14-10-12-16(13-11-14)22-15-8-6-5-7-9-15/h5-13,22H,1-4H3 |
| InChIKey | SKRCFIYRXVPAKK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-phenyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline?
The IUPAC name of N-phenyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline (CID 71211638) is N-phenyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline.
What is the SMILES notation for N-phenyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline?
The canonical SMILES for N-phenyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline is CC(O[Si](C)(C)C)(c1ccc(Nc2ccccc2)cc1)C(F)(F)F.
What is the InChIKey of N-phenyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline?
The InChIKey is SKRCFIYRXVPAKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F3NOSi/c1-17(18(19,20)21,23-24(2,3)4)14-10-12-16(13-11-14)22-15-8-6-5-7-9-15/h5-13,22H,1-4H3.
What are the key properties of N-phenyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline?
N-phenyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline has a molecular weight of 353.46 g/mol, XLogP of 6.06, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-4-(1,1,1-trifluoro-2-trimethylsilyloxypropan-2-yl)aniline is sourced from PubChem (CID 71211638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).