C17H19N5 — CID 71212257
2-[4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]acetonitrile (PubChem CID 71212257) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-[4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]acetonitrile.
| Compound Name | 2-[4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]acetonitrile |
|---|---|
| PubChem CID | 71212257 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-[4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]acetonitrile |
| SMILES | Cc1nc2cnc3[nH]ccc3c2n1C1CCC(CC#N)CC1 |
| InChI | InChI=1S/C17H19N5/c1-11-21-15-10-20-17-14(7-9-19-17)16(15)22(11)13-4-2-12(3-5-13)6-8-18/h7,9-10,12-13H,2-6H2,1H3,(H,19,20) |
| InChIKey | OETPUWNRYNOSLM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |