C16H16FNO2 — CID 712123
3-(4-ethoxyphenyl)-6-fluoro-2,4-dihydro-1,3-benzoxazine (PubChem CID 712123) has the molecular formula C16H16FNO2 and a molecular weight of 273.31 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-6-fluoro-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 3-(4-ethoxyphenyl)-6-fluoro-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 712123 |
| Molecular Formula | C16H16FNO2 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3-(4-ethoxyphenyl)-6-fluoro-2,4-dihydro-1,3-benzoxazine |
| SMILES | CCOc1ccc(N2COc3ccc(F)cc3C2)cc1 |
| InChI | InChI=1S/C16H16FNO2/c1-2-19-15-6-4-14(5-7-15)18-10-12-9-13(17)3-8-16(12)20-11-18/h3-9H,2,10-11H2,1H3 |
| InChIKey | OTNBYSZRBMNORA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|