C13H24N2O3S — CID 71212541
5-[(2S,3S,4S)-3,4-dimethyl-3-(methylcarbamoylamino)thiolan-2-yl]pentanoic acid (PubChem CID 71212541) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is 5-[(2S,3S,4S)-3,4-dimethyl-3-(methylcarbamoylamino)thiolan-2-yl]pentanoic acid.
| Compound Name | 5-[(2S,3S,4S)-3,4-dimethyl-3-(methylcarbamoylamino)thiolan-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 71212541 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 5-[(2S,3S,4S)-3,4-dimethyl-3-(methylcarbamoylamino)thiolan-2-yl]pentanoic acid |
| SMILES | CNC(=O)N[C@@]1(C)[C@H](C)CS[C@H]1CCCCC(=O)O |
| InChI | InChI=1S/C13H24N2O3S/c1-9-8-19-10(6-4-5-7-11(16)17)13(9,2)15-12(18)14-3/h9-10H,4-8H2,1-3H3,(H,16,17)(H2,14,15,18)/t9-,10+,13+/m1/s1 |
| InChIKey | RLYDSVPWHZRMCL-NRUUGDAUSA-N |
| XLogP | 2.07 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|