C15H18N4OS — CID 71212579
(1R)-1-[3-(thian-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol (PubChem CID 71212579) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is (1R)-1-[3-(thian-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol.
| Compound Name | (1R)-1-[3-(thian-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
|---|---|
| PubChem CID | 71212579 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (1R)-1-[3-(thian-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
| SMILES | C[C@@H](O)c1nc2cnc3[nH]ccc3c2n1C1CCSCC1 |
| InChI | InChI=1S/C15H18N4OS/c1-9(20)15-18-12-8-17-14-11(2-5-16-14)13(12)19(15)10-3-6-21-7-4-10/h2,5,8-10,20H,3-4,6-7H2,1H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | JEKFKVUNUSJEGF-SECBINFHSA-N |
| XLogP | 3.03 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |