C25H28Cl3N4O+ — CID 71213817
(3R,4S)-3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-4-methyl-N-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ium-2-yl)-3,4-dihydropyrazole-5-carboxamide (PubChem CID 71213817) has the molecular formula C25H28Cl3N4O+ and a molecular weight of 506.89 g/mol. Its IUPAC name is (3R,4S)-3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-4-methyl-N-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ium-2-yl)-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | (3R,4S)-3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-4-methyl-N-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ium-2-yl)-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 71213817 |
| Molecular Formula | C25H28Cl3N4O+ |
| Molecular Weight | 506.89 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | (3R,4S)-3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-4-methyl-N-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ium-2-yl)-3,4-dihydropyrazole-5-carboxamide |
| SMILES | C[C@@H]1C(C(=O)N[N+]2(C)CC3CCCC3C2)=NN(c2ccc(Cl)cc2Cl)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H27Cl3N4O/c1-15-23(25(33)30-32(2)13-17-4-3-5-18(17)14-32)29-31(22-11-10-20(27)12-21(22)28)24(15)16-6-8-19(26)9-7-16/h6-12,15,17-18,24H,3-5,13-14H2,1-2H3/p+1/t15-,17?,18?,24-,32?/m1/s1 |
| InChIKey | HMCWNXOJQHXRSV-GYEUATKJSA-O |
| XLogP | 6.11 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.89 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|