C21H27NO3 — CID 71213854
(2E)-2-[5-(1-hydroxyethyl)-6-methoxy-3,3-dimethyl-2H-inden-1-ylidene]-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 71213854) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is (2E)-2-[5-(1-hydroxyethyl)-6-methoxy-3,3-dimethyl-2H-inden-1-ylidene]-4,4-dimethyl-3-oxopentanenitrile.
| Compound Name | (2E)-2-[5-(1-hydroxyethyl)-6-methoxy-3,3-dimethyl-2H-inden-1-ylidene]-4,4-dimethyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 71213854 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (2E)-2-[5-(1-hydroxyethyl)-6-methoxy-3,3-dimethyl-2H-inden-1-ylidene]-4,4-dimethyl-3-oxopentanenitrile |
| SMILES | COc1cc2c(cc1C(C)O)C(C)(C)C/C2=C(/C#N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C21H27NO3/c1-12(23)13-8-17-14(9-18(13)25-7)15(10-21(17,5)6)16(11-22)19(24)20(2,3)4/h8-9,12,23H,10H2,1-7H3/b16-15+ |
| InChIKey | FETWDGXWXXCKSC-FOCLMDBBSA-N |
| XLogP | 4.32 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|