C15H23NO — CID 71214120
2-hydroxy-1,1,3,3,6,6-hexamethylcyclohepta[c]pyrrole (PubChem CID 71214120) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 2-hydroxy-1,1,3,3,6,6-hexamethylcyclohepta[c]pyrrole.
| Compound Name | 2-hydroxy-1,1,3,3,6,6-hexamethylcyclohepta[c]pyrrole |
|---|---|
| PubChem CID | 71214120 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 2-hydroxy-1,1,3,3,6,6-hexamethylcyclohepta[c]pyrrole |
| SMILES | CC1(C)C=CC2=C(C=C1)C(C)(C)N(O)C2(C)C |
| InChI | InChI=1S/C15H23NO/c1-13(2)9-7-11-12(8-10-13)15(5,6)16(17)14(11,3)4/h7-10,17H,1-6H3 |
| InChIKey | RKLPZJLBNSVDNL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |