C19H32O2S — CID 71214779
[(1R,4aR,7R)-1,4a,7-trimethyl-2,3,4,6,7,8,8a,9,10,10a-decahydrophenanthren-1-yl]methyl methanesulfinate (PubChem CID 71214779) has the molecular formula C19H32O2S and a molecular weight of 324.53 g/mol. Its IUPAC name is [(1R,4aR,7R)-1,4a,7-trimethyl-2,3,4,6,7,8,8a,9,10,10a-decahydrophenanthren-1-yl]methyl methanesulfinate.
| Compound Name | [(1R,4aR,7R)-1,4a,7-trimethyl-2,3,4,6,7,8,8a,9,10,10a-decahydrophenanthren-1-yl]methyl methanesulfinate |
|---|---|
| PubChem CID | 71214779 |
| Molecular Formula | C19H32O2S |
| Molecular Weight | 324.53 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | [(1R,4aR,7R)-1,4a,7-trimethyl-2,3,4,6,7,8,8a,9,10,10a-decahydrophenanthren-1-yl]methyl methanesulfinate |
| SMILES | C[C@@H]1CC=C2C(CCC3[C@](C)(COS(C)=O)CCC[C@@]23C)C1 |
| InChI | InChI=1S/C19H32O2S/c1-14-6-8-16-15(12-14)7-9-17-18(2,13-21-22(4)20)10-5-11-19(16,17)3/h8,14-15,17H,5-7,9-13H2,1-4H3/t14-,15?,17?,18+,19+,22?/m1/s1 |
| InChIKey | YEYBJJOIOFSQRG-WOIDTSMQSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|