C20H17ClFN5 — CID 71215296
3-[(8aS)-6-[2-(5-chloro-2-fluorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile (PubChem CID 71215296) has the molecular formula C20H17ClFN5 and a molecular weight of 381.84 g/mol. Its IUPAC name is 3-[(8aS)-6-[2-(5-chloro-2-fluorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[(8aS)-6-[2-(5-chloro-2-fluorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 71215296 |
| Molecular Formula | C20H17ClFN5 |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 3-[(8aS)-6-[2-(5-chloro-2-fluorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1N1CCN2C(C#Cc3cc(Cl)ccc3F)CC[C@H]2C1 |
| InChI | InChI=1S/C20H17ClFN5/c21-15-2-6-18(22)14(11-15)1-3-16-4-5-17-13-26(9-10-27(16)17)20-19(12-23)24-7-8-25-20/h2,6-8,11,16-17H,4-5,9-10,13H2/t16?,17-/m0/s1 |
| InChIKey | ZJXPOLPHDPMJPV-DJNXLDHESA-N |
| XLogP | 2.85 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|