C11H14BrNO2 — CID 71215345
methyl 3-bromo-1,4,7-trimethyl-7-azabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate (PubChem CID 71215345) has the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. Its IUPAC name is methyl 3-bromo-1,4,7-trimethyl-7-azabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate.
| Compound Name | methyl 3-bromo-1,4,7-trimethyl-7-azabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
|---|---|
| PubChem CID | 71215345 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | methyl 3-bromo-1,4,7-trimethyl-7-azabicyclo[2.2.1]hepta-2,5-diene-2-carboxylate |
| SMILES | COC(=O)C1=C(Br)C2(C)C=CC1(C)N2C |
| InChI | InChI=1S/C11H14BrNO2/c1-10-5-6-11(2,13(10)3)8(12)7(10)9(14)15-4/h5-6H,1-4H3 |
| InChIKey | TUIWZJWYMGLXQS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|