C24H39NO3 — CID 71215372
(2,2,6,6-tetramethylpiperidin-4-yl) 3,5-dibutyl-4-hydroxybenzoate (PubChem CID 71215372) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) 3,5-dibutyl-4-hydroxybenzoate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) 3,5-dibutyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 71215372 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) 3,5-dibutyl-4-hydroxybenzoate |
| SMILES | CCCCc1cc(C(=O)OC2CC(C)(C)NC(C)(C)C2)cc(CCCC)c1O |
| InChI | InChI=1S/C24H39NO3/c1-7-9-11-17-13-19(14-18(21(17)26)12-10-8-2)22(27)28-20-15-23(3,4)25-24(5,6)16-20/h13-14,20,25-26H,7-12,15-16H2,1-6H3 |
| InChIKey | PARARHPTUVWDKL-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |