C13H21NO6 — CID 71215418
(1R,2R,3R,6S)-6-[methyl-[(1S,4R,5R,6R)-4,5,6-trihydroxycyclohex-2-en-1-yl]amino]cyclohex-4-ene-1,2,3-triol (PubChem CID 71215418) has the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. Its IUPAC name is (1R,2R,3R,6S)-6-[methyl-[(1S,4R,5R,6R)-4,5,6-trihydroxycyclohex-2-en-1-yl]amino]cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1R,2R,3R,6S)-6-[methyl-[(1S,4R,5R,6R)-4,5,6-trihydroxycyclohex-2-en-1-yl]amino]cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 71215418 |
| Molecular Formula | C13H21NO6 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | (1R,2R,3R,6S)-6-[methyl-[(1S,4R,5R,6R)-4,5,6-trihydroxycyclohex-2-en-1-yl]amino]cyclohex-4-ene-1,2,3-triol |
| SMILES | CN([C@H]1C=C[C@@H](O)[C@@H](O)[C@@H]1O)[C@H]1C=C[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H21NO6/c1-14(6-2-4-8(15)12(19)10(6)17)7-3-5-9(16)13(20)11(7)18/h2-13,15-20H,1H3/t6-,7-,8+,9+,10+,11+,12+,13+/m0/s1 |
| InChIKey | ZVFIZIPIYOJVDL-AYACBIJXSA-N |
| XLogP | -3.04 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|