C13H20N2 — CID 71215497
2-[[(2S)-1-propylpyrrolidin-2-yl]methyl]pyridine (PubChem CID 71215497) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 2-[[(2S)-1-propylpyrrolidin-2-yl]methyl]pyridine.
| Compound Name | 2-[[(2S)-1-propylpyrrolidin-2-yl]methyl]pyridine |
|---|---|
| PubChem CID | 71215497 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 2-[[(2S)-1-propylpyrrolidin-2-yl]methyl]pyridine |
| SMILES | CCCN1CCC[C@H]1Cc1ccccn1 |
| InChI | InChI=1S/C13H20N2/c1-2-9-15-10-5-7-13(15)11-12-6-3-4-8-14-12/h3-4,6,8,13H,2,5,7,9-11H2,1H3/t13-/m0/s1 |
| InChIKey | GPMCYCIWMWIOEZ-ZDUSSCGKSA-N |
| XLogP | 2.50 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |