About (6S)-2,6-dimethyl-5-phenylsulfanylcyclohexa-1,3-diene
(6S)-2,6-dimethyl-5-phenylsulfanylcyclohexa-1,3-diene (PubChem CID 71215581) has the molecular formula C14H16S
and a molecular weight of 216.35 g/mol. Its IUPAC name is (6S)-2,6-dimethyl-5-phenylsulfanylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | (6S)-2,6-dimethyl-5-phenylsulfanylcyclohexa-1,3-diene |
| PubChem CID | 71215581 |
| Molecular Formula | C14H16S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (6S)-2,6-dimethyl-5-phenylsulfanylcyclohexa-1,3-diene |
| SMILES | CC1=C[C@H](C)C(Sc2ccccc2)C=C1 |
| InChI | InChI=1S/C14H16S/c1-11-8-9-14(12(2)10-11)15-13-6-4-3-5-7-13/h3-10,12,14H,1-2H3/t12-,14?/m0/s1 |
| InChIKey | NCCJPMQFUULUCZ-NBFOIZRFSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6S)-2,6-dimethyl-5-phenylsulfanylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2,6-dimethyl-5-phenylsulfanylcyclohexa-1,3-diene?
The IUPAC name of (6S)-2,6-dimethyl-5-phenylsulfanylcyclohexa-1,3-diene (CID 71215581) is (6S)-2,6-dimethyl-5-phenylsulfanylcyclohexa-1,3-diene.
What is the SMILES notation for (6S)-2,6-dimethyl-5-phenylsulfanylcyclohexa-1,3-diene?
The canonical SMILES for (6S)-2,6-dimethyl-5-phenylsulfanylcyclohexa-1,3-diene is CC1=C[C@H](C)C(Sc2ccccc2)C=C1.
What is the InChIKey of (6S)-2,6-dimethyl-5-phenylsulfanylcyclohexa-1,3-diene?
The InChIKey is NCCJPMQFUULUCZ-NBFOIZRFSA-N. The full InChI is InChI=1S/C14H16S/c1-11-8-9-14(12(2)10-11)15-13-6-4-3-5-7-13/h3-10,12,14H,1-2H3/t12-,14?/m0/s1.
What are the key properties of (6S)-2,6-dimethyl-5-phenylsulfanylcyclohexa-1,3-diene?
(6S)-2,6-dimethyl-5-phenylsulfanylcyclohexa-1,3-diene has a molecular weight of 216.35 g/mol, XLogP of 4.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2,6-dimethyl-5-phenylsulfanylcyclohexa-1,3-diene is sourced from PubChem (CID 71215581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).