C15H17NO3 — CID 71215713
(12R)-7-methoxy-5-methyl-9-oxa-3-azatetracyclo[6.6.1.01,10.04,15]pentadeca-4(15),5,7,13-tetraen-12-ol (PubChem CID 71215713) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (12R)-7-methoxy-5-methyl-9-oxa-3-azatetracyclo[6.6.1.01,10.04,15]pentadeca-4(15),5,7,13-tetraen-12-ol.
| Compound Name | (12R)-7-methoxy-5-methyl-9-oxa-3-azatetracyclo[6.6.1.01,10.04,15]pentadeca-4(15),5,7,13-tetraen-12-ol |
|---|---|
| PubChem CID | 71215713 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (12R)-7-methoxy-5-methyl-9-oxa-3-azatetracyclo[6.6.1.01,10.04,15]pentadeca-4(15),5,7,13-tetraen-12-ol |
| SMILES | COc1cc(C)c2c3c1OC1C[C@@H](O)C=CC31CN2 |
| InChI | InChI=1S/C15H17NO3/c1-8-5-10(18-2)14-12-13(8)16-7-15(12)4-3-9(17)6-11(15)19-14/h3-5,9,11,16-17H,6-7H2,1-2H3/t9-,11?,15?/m0/s1 |
| InChIKey | OKJIAVLMHLSWKW-IEBVAXJPSA-N |
| XLogP | 1.75 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|