C39H37IN2O7 — CID 71215750
1-O-[(4-iodophenyl)methyl] 5-O-[(1S,12R,14S)-9-methoxy-4-(naphthalen-1-ylcarbamoyl)-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] pentanedioate (PubChem CID 71215750) has the molecular formula C39H37IN2O7 and a molecular weight of 772.64 g/mol. Its IUPAC name is 1-O-[(4-iodophenyl)methyl] 5-O-[(1S,12R,14S)-9-methoxy-4-(naphthalen-1-ylcarbamoyl)-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] pentanedioate.
| Compound Name | 1-O-[(4-iodophenyl)methyl] 5-O-[(1S,12R,14S)-9-methoxy-4-(naphthalen-1-ylcarbamoyl)-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] pentanedioate |
|---|---|
| PubChem CID | 71215750 |
| Molecular Formula | C39H37IN2O7 |
| Molecular Weight | 772.64 g/mol |
| Exact Mass | 772.16 |
| IUPAC Name | 1-O-[(4-iodophenyl)methyl] 5-O-[(1S,12R,14S)-9-methoxy-4-(naphthalen-1-ylcarbamoyl)-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] pentanedioate |
| SMILES | COc1ccc2c3c1O[C@@H]1C[C@H](OC(=O)CCCC(=O)OCc4ccc(I)cc4)C=C[C@@]31CCN(C(=O)Nc1cccc3ccccc13)C2 |
| InChI | InChI=1S/C39H37IN2O7/c1-46-32-17-14-27-23-42(38(45)41-31-9-4-7-26-6-2-3-8-30(26)31)21-20-39-19-18-29(22-33(39)49-37(32)36(27)39)48-35(44)11-5-10-34(43)47-24-25-12-15-28(40)16-13-25/h2-4,6-9,12-19,29,33H,5,10-11,20-24H2,1H3,(H,41,45)/t29-,33-,39+/m1/s1 |
| InChIKey | MFZQKQSQKRPJFH-ZTECWAISSA-N |
| XLogP | 7.68 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.64 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|